C12H19F2N3S — CID 114206939
1-[2-(butan-2-ylsulfanylmethyl)-4-(difluoromethyl)pyrimidin-5-yl]-N-methylmethanamine (PubChem CID 114206939) has the molecular formula C12H19F2N3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-[2-(butan-2-ylsulfanylmethyl)-4-(difluoromethyl)pyrimidin-5-yl]-N-methylmethanamine.
| Compound Name | 1-[2-(butan-2-ylsulfanylmethyl)-4-(difluoromethyl)pyrimidin-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114206939 |
| Molecular Formula | C12H19F2N3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-[2-(butan-2-ylsulfanylmethyl)-4-(difluoromethyl)pyrimidin-5-yl]-N-methylmethanamine |
| SMILES | CCC(C)SCc1ncc(CNC)c(C(F)F)n1 |
| InChI | InChI=1S/C12H19F2N3S/c1-4-8(2)18-7-10-16-6-9(5-15-3)11(17-10)12(13)14/h6,8,12,15H,4-5,7H2,1-3H3 |
| InChIKey | AGBKNIPPEUYMKI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |