C9H11F2N3O — CID 170542917
[2-(azetidin-1-yl)-4-(difluoromethyl)pyrimidin-5-yl]methanol (PubChem CID 170542917) has the molecular formula C9H11F2N3O and a molecular weight of 215.20 g/mol. Its IUPAC name is [2-(azetidin-1-yl)-4-(difluoromethyl)pyrimidin-5-yl]methanol.
| Compound Name | [2-(azetidin-1-yl)-4-(difluoromethyl)pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 170542917 |
| Molecular Formula | C9H11F2N3O |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | [2-(azetidin-1-yl)-4-(difluoromethyl)pyrimidin-5-yl]methanol |
| SMILES | OCc1cnc(N2CCC2)nc1C(F)F |
| InChI | InChI=1S/C9H11F2N3O/c10-8(11)7-6(5-15)4-12-9(13-7)14-2-1-3-14/h4,8,15H,1-3,5H2 |
| InChIKey | IDVKGCCBJNROGQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |