C7H9F2N3O — CID 126974118
[4-(difluoromethyl)-2-(methylamino)pyrimidin-5-yl]methanol (PubChem CID 126974118) has the molecular formula C7H9F2N3O and a molecular weight of 189.16 g/mol. Its IUPAC name is [4-(difluoromethyl)-2-(methylamino)pyrimidin-5-yl]methanol.
| Compound Name | [4-(difluoromethyl)-2-(methylamino)pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 126974118 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | [4-(difluoromethyl)-2-(methylamino)pyrimidin-5-yl]methanol |
| SMILES | CNc1ncc(CO)c(C(F)F)n1 |
| InChI | InChI=1S/C7H9F2N3O/c1-10-7-11-2-4(3-13)5(12-7)6(8)9/h2,6,13H,3H2,1H3,(H,10,11,12) |
| InChIKey | LPUXSXXHWCLYLF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |