C19H35N3 — CID 163389278
4-butan-2-yl-N-methyl-5-[(Z)-4-methylpent-2-en-3-yl]pyrimidin-2-amine;2-methylpropane (PubChem CID 163389278) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is 4-butan-2-yl-N-methyl-5-[(Z)-4-methylpent-2-en-3-yl]pyrimidin-2-amine;2-methylpropane.
| Compound Name | 4-butan-2-yl-N-methyl-5-[(Z)-4-methylpent-2-en-3-yl]pyrimidin-2-amine;2-methylpropane |
|---|---|
| PubChem CID | 163389278 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | 4-butan-2-yl-N-methyl-5-[(Z)-4-methylpent-2-en-3-yl]pyrimidin-2-amine;2-methylpropane |
| SMILES | C/C=C(\c1cnc(NC)nc1C(C)CC)C(C)C.CC(C)C |
| InChI | InChI=1S/C15H25N3.C4H10/c1-7-11(5)14-13(12(8-2)10(3)4)9-17-15(16-6)18-14;1-4(2)3/h8-11H,7H2,1-6H3,(H,16,17,18);4H,1-3H3/b12-8-; |
| InChIKey | TWJKJJFHKHBDGX-JCTPKUEWSA-N |
| XLogP | 5.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |