C9H14BrN3 — CID 130483355
5-(bromomethyl)-N-methyl-4-propan-2-ylpyrimidin-2-amine (PubChem CID 130483355) has the molecular formula C9H14BrN3 and a molecular weight of 244.14 g/mol. Its IUPAC name is 5-(bromomethyl)-N-methyl-4-propan-2-ylpyrimidin-2-amine.
| Compound Name | 5-(bromomethyl)-N-methyl-4-propan-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 130483355 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 5-(bromomethyl)-N-methyl-4-propan-2-ylpyrimidin-2-amine |
| SMILES | CNc1ncc(CBr)c(C(C)C)n1 |
| InChI | InChI=1S/C9H14BrN3/c1-6(2)8-7(4-10)5-12-9(11-3)13-8/h5-6H,4H2,1-3H3,(H,11,12,13) |
| InChIKey | QNZCVBKYEIAAFQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|