About 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine
5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine (PubChem CID 114205763) has the molecular formula C13H12BrCl2N3
and a molecular weight of 361.07 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine.
Molecular Properties
| Compound Name | 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine |
| PubChem CID | 114205763 |
| Molecular Formula | C13H12BrCl2N3 |
| Molecular Weight | 361.07 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine |
| SMILES | CC(C)c1nc(-c2ncc(Cl)cc2Cl)ncc1CBr |
| InChI | InChI=1S/C13H12BrCl2N3/c1-7(2)11-8(4-14)5-18-13(19-11)12-10(16)3-9(15)6-17-12/h3,5-7H,4H2,1-2H3 |
| InChIKey | MGHOWZVSDOIGGE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.07 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine?
The IUPAC name of 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine (CID 114205763) is 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine.
What is the SMILES notation for 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine?
The canonical SMILES for 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine is CC(C)c1nc(-c2ncc(Cl)cc2Cl)ncc1CBr.
What is the InChIKey of 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine?
The InChIKey is MGHOWZVSDOIGGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrCl2N3/c1-7(2)11-8(4-14)5-18-13(19-11)12-10(16)3-9(15)6-17-12/h3,5-7H,4H2,1-2H3.
What are the key properties of 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine?
5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine has a molecular weight of 361.07 g/mol, XLogP of 4.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-2-(3,5-dichloro-2-pyridinyl)-4-propan-2-ylpyrimidine is sourced from PubChem (CID 114205763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).