C12H11Cl2IN4 — CID 79780014
2-(3,5-dichloro-2-pyridinyl)-5-iodo-6-propan-2-ylpyrimidin-4-amine (PubChem CID 79780014) has the molecular formula C12H11Cl2IN4 and a molecular weight of 409.06 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-pyridinyl)-5-iodo-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-(3,5-dichloro-2-pyridinyl)-5-iodo-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79780014 |
| Molecular Formula | C12H11Cl2IN4 |
| Molecular Weight | 409.06 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 2-(3,5-dichloro-2-pyridinyl)-5-iodo-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1nc(-c2ncc(Cl)cc2Cl)nc(N)c1I |
| InChI | InChI=1S/C12H11Cl2IN4/c1-5(2)9-8(15)11(16)19-12(18-9)10-7(14)3-6(13)4-17-10/h3-5H,1-2H3,(H2,16,18,19) |
| InChIKey | BKBWVOVIZSQEJM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.06 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|