C10H6ClF3N4 — CID 1483168
5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrimidin-2-amine (PubChem CID 1483168) has the molecular formula C10H6ClF3N4 and a molecular weight of 274.63 g/mol. Its IUPAC name is 5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrimidin-2-amine.
| Compound Name | 5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 1483168 |
| Molecular Formula | C10H6ClF3N4 |
| Molecular Weight | 274.63 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2ncc(C(F)(F)F)cc2Cl)cn1 |
| InChI | InChI=1S/C10H6ClF3N4/c11-7-1-6(10(12,13)14)4-16-8(7)5-2-17-9(15)18-3-5/h1-4H,(H2,15,17,18) |
| InChIKey | QONSTICETYKNTD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |