C12H10Cl3N3 — CID 114205364
5-(chloromethyl)-2-(3,5-dichloro-2-pyridinyl)-4-ethylpyrimidine (PubChem CID 114205364) has the molecular formula C12H10Cl3N3 and a molecular weight of 302.59 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(3,5-dichloro-2-pyridinyl)-4-ethylpyrimidine.
| Compound Name | 5-(chloromethyl)-2-(3,5-dichloro-2-pyridinyl)-4-ethylpyrimidine |
|---|---|
| PubChem CID | 114205364 |
| Molecular Formula | C12H10Cl3N3 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 5-(chloromethyl)-2-(3,5-dichloro-2-pyridinyl)-4-ethylpyrimidine |
| SMILES | CCc1nc(-c2ncc(Cl)cc2Cl)ncc1CCl |
| InChI | InChI=1S/C12H10Cl3N3/c1-2-10-7(4-13)5-17-12(18-10)11-9(15)3-8(14)6-16-11/h3,5-6H,2,4H2,1H3 |
| InChIKey | BRJVYWYXHRCTIP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|