C10H10Cl2N4S — CID 79777620
3-(3,5-dichloro-2-pyridinyl)-N-propyl-1,2,4-thiadiazol-5-amine (PubChem CID 79777620) has the molecular formula C10H10Cl2N4S and a molecular weight of 289.19 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-pyridinyl)-N-propyl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(3,5-dichloro-2-pyridinyl)-N-propyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 79777620 |
| Molecular Formula | C10H10Cl2N4S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 3-(3,5-dichloro-2-pyridinyl)-N-propyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCCNc1nc(-c2ncc(Cl)cc2Cl)ns1 |
| InChI | InChI=1S/C10H10Cl2N4S/c1-2-3-13-10-15-9(16-17-10)8-7(12)4-6(11)5-14-8/h4-5H,2-3H2,1H3,(H,13,15,16) |
| InChIKey | LDUHODAFOWPUFQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |