C9H11N3S2 — CID 65268420
N-propyl-3-thiophen-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 65268420) has the molecular formula C9H11N3S2 and a molecular weight of 225.34 g/mol. Its IUPAC name is N-propyl-3-thiophen-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-propyl-3-thiophen-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65268420 |
| Molecular Formula | C9H11N3S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | N-propyl-3-thiophen-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CCCNc1nc(-c2cccs2)ns1 |
| InChI | InChI=1S/C9H11N3S2/c1-2-5-10-9-11-8(12-14-9)7-4-3-6-13-7/h3-4,6H,2,5H2,1H3,(H,10,11,12) |
| InChIKey | HVEFRXPWNVTTSQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |