C8H6Cl2F3N — CID 139336058
2,6-dichloro-3-ethyl-5-(trifluoromethyl)pyridine (PubChem CID 139336058) has the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. Its IUPAC name is 2,6-dichloro-3-ethyl-5-(trifluoromethyl)pyridine.
| Compound Name | 2,6-dichloro-3-ethyl-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 139336058 |
| Molecular Formula | C8H6Cl2F3N |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | 2,6-dichloro-3-ethyl-5-(trifluoromethyl)pyridine |
| SMILES | CCc1cc(C(F)(F)F)c(Cl)nc1Cl |
| InChI | InChI=1S/C8H6Cl2F3N/c1-2-4-3-5(8(11,12)13)7(10)14-6(4)9/h3H,2H2,1H3 |
| InChIKey | PRELEUJGRJAWAB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|