C7H13ClN4 — CID 133062849
5-(aminomethyl)-2-ethylpyrimidin-4-amine;hydrochloride (PubChem CID 133062849) has the molecular formula C7H13ClN4 and a molecular weight of 188.66 g/mol. Its IUPAC name is 5-(aminomethyl)-2-ethylpyrimidin-4-amine;hydrochloride.
| Compound Name | 5-(aminomethyl)-2-ethylpyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 133062849 |
| Molecular Formula | C7H13ClN4 |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 5-(aminomethyl)-2-ethylpyrimidin-4-amine;hydrochloride |
| SMILES | CCc1ncc(CN)c(N)n1.Cl |
| InChI | InChI=1S/C7H12N4.ClH/c1-2-6-10-4-5(3-8)7(9)11-6;/h4H,2-3,8H2,1H3,(H2,9,10,11);1H |
| InChIKey | XEWWQKKPTOHSGV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |