C13H18ClFN4S — CID 71609331
2-ethyl-5-[[5-(2-fluoroethyl)-4-methyl-1,3-thiazol-3-ium-3-yl]methyl]pyrimidin-4-amine chloride (PubChem CID 71609331) has the molecular formula C13H18ClFN4S and a molecular weight of 316.83 g/mol. Its IUPAC name is 2-ethyl-5-[[5-(2-fluoroethyl)-4-methyl-1,3-thiazol-3-ium-3-yl]methyl]pyrimidin-4-amine chloride.
| Compound Name | 2-ethyl-5-[[5-(2-fluoroethyl)-4-methyl-1,3-thiazol-3-ium-3-yl]methyl]pyrimidin-4-amine chloride |
|---|---|
| PubChem CID | 71609331 |
| Molecular Formula | C13H18ClFN4S |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-ethyl-5-[[5-(2-fluoroethyl)-4-methyl-1,3-thiazol-3-ium-3-yl]methyl]pyrimidin-4-amine chloride |
| SMILES | CCc1ncc(C[n+]2csc(CCF)c2C)c(N)n1.[Cl-] |
| InChI | InChI=1S/C13H18FN4S.ClH/c1-3-12-16-6-10(13(15)17-12)7-18-8-19-11(4-5-14)9(18)2;/h6,8H,3-5,7H2,1-2H3,(H2,15,16,17);1H/q+1;/p-1 |
| InChIKey | HCLHRLDTPBCHRX-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|