C15H17N4S+ — CID 21416672
2-ethyl-5-[(4-methylthieno[3,2-c]pyridin-5-ium-5-yl)methyl]pyrimidin-4-amine (PubChem CID 21416672) has the molecular formula C15H17N4S+ and a molecular weight of 285.40 g/mol. Its IUPAC name is 2-ethyl-5-[(4-methylthieno[3,2-c]pyridin-5-ium-5-yl)methyl]pyrimidin-4-amine.
| Compound Name | 2-ethyl-5-[(4-methylthieno[3,2-c]pyridin-5-ium-5-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21416672 |
| Molecular Formula | C15H17N4S+ |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-ethyl-5-[(4-methylthieno[3,2-c]pyridin-5-ium-5-yl)methyl]pyrimidin-4-amine |
| SMILES | CCc1ncc(C[n+]2ccc3sccc3c2C)c(N)n1 |
| InChI | InChI=1S/C15H17N4S/c1-3-14-17-8-11(15(16)18-14)9-19-6-4-13-12(10(19)2)5-7-20-13/h4-8H,3,9H2,1-2H3,(H2,16,17,18)/q+1 |
| InChIKey | DUALOQSRFGKLME-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|