C8H11Cl2N3 — CID 123359633
2,5-bis(2-chloroethyl)pyrimidin-4-amine (PubChem CID 123359633) has the molecular formula C8H11Cl2N3 and a molecular weight of 220.10 g/mol. Its IUPAC name is 2,5-bis(2-chloroethyl)pyrimidin-4-amine.
| Compound Name | 2,5-bis(2-chloroethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 123359633 |
| Molecular Formula | C8H11Cl2N3 |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 2,5-bis(2-chloroethyl)pyrimidin-4-amine |
| SMILES | Nc1nc(CCCl)ncc1CCCl |
| InChI | InChI=1S/C8H11Cl2N3/c9-3-1-6-5-12-7(2-4-10)13-8(6)11/h5H,1-4H2,(H2,11,12,13) |
| InChIKey | DOKUINXAWXHRFQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|