C6H9IN4 — CID 130205960
5-(2-iodoethyl)pyrimidine-2,4-diamine (PubChem CID 130205960) has the molecular formula C6H9IN4 and a molecular weight of 264.07 g/mol. Its IUPAC name is 5-(2-iodoethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(2-iodoethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 130205960 |
| Molecular Formula | C6H9IN4 |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 5-(2-iodoethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(CCI)c(N)n1 |
| InChI | InChI=1S/C6H9IN4/c7-2-1-4-3-10-6(9)11-5(4)8/h3H,1-2H2,(H4,8,9,10,11) |
| InChIKey | GKVCYUTYIDYDNV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|