C8H12N4O — CID 145385503
5-(oxetan-3-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 145385503) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-(oxetan-3-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(oxetan-3-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145385503 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 5-(oxetan-3-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(CC2COC2)c(N)n1 |
| InChI | InChI=1S/C8H12N4O/c9-7-6(1-5-3-13-4-5)2-11-8(10)12-7/h2,5H,1,3-4H2,(H4,9,10,11,12) |
| InChIKey | ITKOPYNJGFOOKA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |