C7H13N5O — CID 131098978
2-amino-3-(2,4-diaminopyrimidin-5-yl)propan-1-ol (PubChem CID 131098978) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 2-amino-3-(2,4-diaminopyrimidin-5-yl)propan-1-ol.
| Compound Name | 2-amino-3-(2,4-diaminopyrimidin-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 131098978 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-amino-3-(2,4-diaminopyrimidin-5-yl)propan-1-ol |
| SMILES | Nc1ncc(CC(N)CO)c(N)n1 |
| InChI | InChI=1S/C7H13N5O/c8-5(3-13)1-4-2-11-7(10)12-6(4)9/h2,5,13H,1,3,8H2,(H4,9,10,11,12) |
| InChIKey | QOORBTUTVLRERG-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |