C5H8N4S — CID 141014198
(2,4-diaminopyrimidin-5-yl)methanethiol (PubChem CID 141014198) has the molecular formula C5H8N4S and a molecular weight of 156.21 g/mol. Its IUPAC name is (2,4-diaminopyrimidin-5-yl)methanethiol.
| Compound Name | (2,4-diaminopyrimidin-5-yl)methanethiol |
|---|---|
| PubChem CID | 141014198 |
| Molecular Formula | C5H8N4S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | (2,4-diaminopyrimidin-5-yl)methanethiol |
| SMILES | Nc1ncc(CS)c(N)n1 |
| InChI | InChI=1S/C5H8N4S/c6-4-3(2-10)1-8-5(7)9-4/h1,10H,2H2,(H4,6,7,8,9) |
| InChIKey | UFKRTGKYWXXDOB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|