C7H13N5 — CID 150048072
[2,4-bis(aminomethyl)pyrimidin-5-yl]methanamine (PubChem CID 150048072) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is [2,4-bis(aminomethyl)pyrimidin-5-yl]methanamine.
| Compound Name | [2,4-bis(aminomethyl)pyrimidin-5-yl]methanamine |
|---|---|
| PubChem CID | 150048072 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | [2,4-bis(aminomethyl)pyrimidin-5-yl]methanamine |
| SMILES | NCc1ncc(CN)c(CN)n1 |
| InChI | InChI=1S/C7H13N5/c8-1-5-4-11-7(3-10)12-6(5)2-9/h4H,1-3,8-10H2 |
| InChIKey | DKSBZMXESTXQOQ-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |