C9H13NO — CID 10329448
5-ethyl-2,6-dimethylpyridin-3-ol (PubChem CID 10329448) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 5-ethyl-2,6-dimethylpyridin-3-ol.
| Compound Name | 5-ethyl-2,6-dimethylpyridin-3-ol |
|---|---|
| PubChem CID | 10329448 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 5-ethyl-2,6-dimethylpyridin-3-ol |
| SMILES | CCc1cc(O)c(C)nc1C |
| InChI | InChI=1S/C9H13NO/c1-4-8-5-9(11)7(3)10-6(8)2/h5,11H,4H2,1-3H3 |
| InChIKey | XTRNUDAJLLLSNB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |