C13H16FN — CID 143910995
6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline (PubChem CID 143910995) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline.
| Compound Name | 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline |
|---|---|
| PubChem CID | 143910995 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 6-ethyl-2-(1-fluoroethyl)-6,7-dihydroquinoline |
| SMILES | CCC1C=c2ccc(C(C)F)nc2=CC1 |
| InChI | InChI=1S/C13H16FN/c1-3-10-4-6-13-11(8-10)5-7-12(15-13)9(2)14/h5-10H,3-4H2,1-2H3 |
| InChIKey | AUEYTSAGQONZGH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |