C18H20N2 — CID 142740010
9-(cyclohexylmethyl)-9H-pyrido[3,2-b]indole (PubChem CID 142740010) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 9-(cyclohexylmethyl)-9H-pyrido[3,2-b]indole.
| Compound Name | 9-(cyclohexylmethyl)-9H-pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 142740010 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 9-(cyclohexylmethyl)-9H-pyrido[3,2-b]indole |
| SMILES | C1=CC(CC2CCCCC2)C2=c3ncccc3=NC2=C1 |
| InChI | InChI=1S/C18H20N2/c1-2-6-13(7-3-1)12-14-8-4-9-15-17(14)18-16(20-15)10-5-11-19-18/h4-5,8-11,13-14H,1-3,6-7,12H2 |
| InChIKey | XJARZPDXZCDZSL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |