C16H19N — CID 141205013
2,3,4,4a,5,6,6a,7-octahydro-1H-naphtho[1,2-f]indole (PubChem CID 141205013) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is 2,3,4,4a,5,6,6a,7-octahydro-1H-naphtho[1,2-f]indole.
| Compound Name | 2,3,4,4a,5,6,6a,7-octahydro-1H-naphtho[1,2-f]indole |
|---|---|
| PubChem CID | 141205013 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2,3,4,4a,5,6,6a,7-octahydro-1H-naphtho[1,2-f]indole |
| SMILES | C1=CC2=CC3=C4CCCCC4CCC3CC2=N1 |
| InChI | InChI=1S/C16H19N/c1-2-4-14-11(3-1)5-6-12-10-16-13(7-8-17-16)9-15(12)14/h7-9,11-12H,1-6,10H2 |
| InChIKey | HKTIWQBCANIFHQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |