About iridium;1-phenyl-4a,8a-dihydroisoquinoline
iridium;1-phenyl-4a,8a-dihydroisoquinoline (PubChem CID 58090503) has the molecular formula C15H12IrN-
and a molecular weight of 398.49 g/mol. Its IUPAC name is iridium;1-phenyl-4a,8a-dihydroisoquinoline.
Molecular Properties
| Compound Name | iridium;1-phenyl-4a,8a-dihydroisoquinoline |
| PubChem CID | 58090503 |
| Molecular Formula | C15H12IrN- |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | iridium;1-phenyl-4a,8a-dihydroisoquinoline |
| SMILES | [Ir].[c-]1ccccc1C1=NC=CC2C=CC=CC12 |
| InChI | InChI=1S/C15H12N.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;/h1-7,9-12,14H;/q-1; |
| InChIKey | PKWSWGJWIMOPGR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-phenyl-4a,8a-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-phenyl-4a,8a-dihydroisoquinoline?
The IUPAC name of iridium;1-phenyl-4a,8a-dihydroisoquinoline (CID 58090503) is iridium;1-phenyl-4a,8a-dihydroisoquinoline.
What is the SMILES notation for iridium;1-phenyl-4a,8a-dihydroisoquinoline?
The canonical SMILES for iridium;1-phenyl-4a,8a-dihydroisoquinoline is [Ir].[c-]1ccccc1C1=NC=CC2C=CC=CC12.
What is the InChIKey of iridium;1-phenyl-4a,8a-dihydroisoquinoline?
The InChIKey is PKWSWGJWIMOPGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;/h1-7,9-12,14H;/q-1;.
What are the key properties of iridium;1-phenyl-4a,8a-dihydroisoquinoline?
iridium;1-phenyl-4a,8a-dihydroisoquinoline has a molecular weight of 398.49 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-phenyl-4a,8a-dihydroisoquinoline is sourced from PubChem (CID 58090503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).