C14H14N2 — CID 54016915
6,8,9,10,10a,10b-hexahydroindolo[4,3-fg]quinoline (PubChem CID 54016915) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 6,8,9,10,10a,10b-hexahydroindolo[4,3-fg]quinoline.
| Compound Name | 6,8,9,10,10a,10b-hexahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 54016915 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 6,8,9,10,10a,10b-hexahydroindolo[4,3-fg]quinoline |
| SMILES | C1=CC2C3=C(C=NC3=C1)CC1=NCCCC12 |
| InChI | InChI=1S/C14H14N2/c1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11/h1,3,5,8,10-11H,2,4,6-7H2 |
| InChIKey | KWGOTQKYWDSWJW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |