C14H14N2 — CID 57158404
4,16-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-1(16),3,6,11,13-pentaene (PubChem CID 57158404) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4,16-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-1(16),3,6,11,13-pentaene.
| Compound Name | 4,16-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-1(16),3,6,11,13-pentaene |
|---|---|
| PubChem CID | 57158404 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4,16-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-1(16),3,6,11,13-pentaene |
| SMILES | C1=CC2C3=NC(CC4=CCN=CC43)C2C=C1 |
| InChI | InChI=1S/C14H14N2/c1-2-4-11-10(3-1)13-7-9-5-6-15-8-12(9)14(11)16-13/h1-5,8,10-13H,6-7H2 |
| InChIKey | MNWFRTCSVLWIKD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|