C14H17N — CID 91445412
3-azatricyclo[9.4.0.02,7]pentadeca-1(15),3,6,13-tetraene (PubChem CID 91445412) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-azatricyclo[9.4.0.02,7]pentadeca-1(15),3,6,13-tetraene.
| Compound Name | 3-azatricyclo[9.4.0.02,7]pentadeca-1(15),3,6,13-tetraene |
|---|---|
| PubChem CID | 91445412 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-azatricyclo[9.4.0.02,7]pentadeca-1(15),3,6,13-tetraene |
| SMILES | C1=CCC2CCCC3=CCC=NC3C2=C1 |
| InChI | InChI=1S/C14H17N/c1-2-9-13-11(5-1)6-3-7-12-8-4-10-15-14(12)13/h1-2,8-11,14H,3-7H2 |
| InChIKey | OSJIZLQNWUFLKW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|