C10H10N2 — CID 57008412
4,6,7,7a-tetrahydropyrrolo[2,3-f]indole (PubChem CID 57008412) has the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 4,6,7,7a-tetrahydropyrrolo[2,3-f]indole.
| Compound Name | 4,6,7,7a-tetrahydropyrrolo[2,3-f]indole |
|---|---|
| PubChem CID | 57008412 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 4,6,7,7a-tetrahydropyrrolo[2,3-f]indole |
| SMILES | C1=NC2=CC3CCN=C3CC2=C1 |
| InChI | InChI=1S/C10H10N2/c1-3-11-9-6-8-2-4-12-10(8)5-7(1)9/h1,3,6,8H,2,4-5H2 |
| InChIKey | FLCDGPGTZACHMS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |