C12H16N2 — CID 123798017
5-tert-butyl-4,5-dihydroindol-6-imine (PubChem CID 123798017) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 5-tert-butyl-4,5-dihydroindol-6-imine.
| Compound Name | 5-tert-butyl-4,5-dihydroindol-6-imine |
|---|---|
| PubChem CID | 123798017 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 5-tert-butyl-4,5-dihydroindol-6-imine |
| SMILES | [H]/N=C1\C=C2N=CC=C2CC1C(C)(C)C |
| InChI | InChI=1S/C12H16N2/c1-12(2,3)9-6-8-4-5-14-11(8)7-10(9)13/h4-5,7,9,13H,6H2,1-3H3/b13-10+ |
| InChIKey | NDPKMJUHJNSHBK-JLHYYAGUSA-N |
| XLogP | 2.97 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|