C19H30N2 — CID 155589754
N-[(1E,7E)-5-ethyl-8-methanimidoyl-3,3-dimethylcycloocta-1,5,7-trien-1-yl]-2,3-dimethylbutan-1-imine (PubChem CID 155589754) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is N-[(1E,7E)-5-ethyl-8-methanimidoyl-3,3-dimethylcycloocta-1,5,7-trien-1-yl]-2,3-dimethylbutan-1-imine.
| Compound Name | N-[(1E,7E)-5-ethyl-8-methanimidoyl-3,3-dimethylcycloocta-1,5,7-trien-1-yl]-2,3-dimethylbutan-1-imine |
|---|---|
| PubChem CID | 155589754 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | N-[(1E,7E)-5-ethyl-8-methanimidoyl-3,3-dimethylcycloocta-1,5,7-trien-1-yl]-2,3-dimethylbutan-1-imine |
| SMILES | [H]/N=C/C1=C/C=C(CC)CC(C)(C)\C=C1\N=C\C(C)C(C)C |
| InChI | InChI=1S/C19H30N2/c1-7-16-8-9-17(12-20)18(11-19(5,6)10-16)21-13-15(4)14(2)3/h8-9,11-15,20H,7,10H2,1-6H3/b16-8?,17-9-,18-11+,20-12+,21-13+ |
| InChIKey | CJQPCBRQWJYYCM-LAWURPIQSA-N |
| XLogP | 5.58 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|