C15H26N2 — CID 123315279
N'-(6,8,9-trimethyldeca-2,4-dien-4-yl)ethane-1,2-diimine (PubChem CID 123315279) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N'-(6,8,9-trimethyldeca-2,4-dien-4-yl)ethane-1,2-diimine.
| Compound Name | N'-(6,8,9-trimethyldeca-2,4-dien-4-yl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 123315279 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N'-(6,8,9-trimethyldeca-2,4-dien-4-yl)ethane-1,2-diimine |
| SMILES | [H]/N=C/C=N/C(C=CC)=CC(C)CC(C)C(C)C |
| InChI | InChI=1S/C15H26N2/c1-6-7-15(17-9-8-16)11-13(4)10-14(5)12(2)3/h6-9,11-14,16H,10H2,1-5H3/b7-6?,15-11?,16-8+,17-9+ |
| InChIKey | OHBVEZRKRIHOAH-NAEICRBTSA-N |
| XLogP | 4.49 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|