C15H24N2 — CID 123833320
N,N-dimethyl-3-(4,5,6-trimethyl-4,5-dihydro-3H-azepin-7-yl)buta-1,3-dien-1-amine (PubChem CID 123833320) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N,N-dimethyl-3-(4,5,6-trimethyl-4,5-dihydro-3H-azepin-7-yl)buta-1,3-dien-1-amine.
| Compound Name | N,N-dimethyl-3-(4,5,6-trimethyl-4,5-dihydro-3H-azepin-7-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 123833320 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N,N-dimethyl-3-(4,5,6-trimethyl-4,5-dihydro-3H-azepin-7-yl)buta-1,3-dien-1-amine |
| SMILES | C=C(C=CN(C)C)C1=C(C)C(C)C(C)CC=N1 |
| InChI | InChI=1S/C15H24N2/c1-11-7-9-16-15(14(4)13(11)3)12(2)8-10-17(5)6/h8-11,13H,2,7H2,1,3-6H3 |
| InChIKey | RNDRGBMGNHHTSJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|