C14H25N — CID 91553754
N-(3,5,6-trimethylocta-1,3-dien-2-yl)propan-1-imine (PubChem CID 91553754) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-(3,5,6-trimethylocta-1,3-dien-2-yl)propan-1-imine.
| Compound Name | N-(3,5,6-trimethylocta-1,3-dien-2-yl)propan-1-imine |
|---|---|
| PubChem CID | 91553754 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-(3,5,6-trimethylocta-1,3-dien-2-yl)propan-1-imine |
| SMILES | C=C(/N=C/CC)C(C)=CC(C)C(C)CC |
| InChI | InChI=1S/C14H25N/c1-7-9-15-14(6)13(5)10-12(4)11(3)8-2/h9-12H,6-8H2,1-5H3/b13-10?,15-9+ |
| InChIKey | YHUZLVPIKKXCGK-MSWWUYRUSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|