C12H17N — CID 91413102
N-[(7Z)-5-methylcycloocta-1,7-dien-1-yl]prop-2-en-1-imine (PubChem CID 91413102) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is N-[(7Z)-5-methylcycloocta-1,7-dien-1-yl]prop-2-en-1-imine.
| Compound Name | N-[(7Z)-5-methylcycloocta-1,7-dien-1-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 91413102 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-[(7Z)-5-methylcycloocta-1,7-dien-1-yl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C1=CCCC(C)C/C=C\1 |
| InChI | InChI=1S/C12H17N/c1-3-10-13-12-8-4-6-11(2)7-5-9-12/h3-4,8-11H,1,5-7H2,2H3/b8-4-,12-9?,13-10+ |
| InChIKey | RQJFKLLFBFYKDM-IJWYQRCRSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|