C14H23N — CID 91475759
N-(5,6-dimethylnona-1,3-dienyl)prop-2-en-1-imine (PubChem CID 91475759) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N-(5,6-dimethylnona-1,3-dienyl)prop-2-en-1-imine.
| Compound Name | N-(5,6-dimethylnona-1,3-dienyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 91475759 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-(5,6-dimethylnona-1,3-dienyl)prop-2-en-1-imine |
| SMILES | C=C/C=N/C=CC=CC(C)C(C)CCC |
| InChI | InChI=1S/C14H23N/c1-5-9-13(3)14(4)10-7-8-12-15-11-6-2/h6-8,10-14H,2,5,9H2,1,3-4H3/b10-7?,12-8?,15-11+ |
| InChIKey | SPDHXSUTJSTXPF-XZFLCJTGSA-N |
| XLogP | 4.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|