C12H17N — CID 91443092
N-[2-(2,6-dimethylcyclohepta-1,3-dien-1-yl)ethenyl]methanimine (PubChem CID 91443092) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is N-[2-(2,6-dimethylcyclohepta-1,3-dien-1-yl)ethenyl]methanimine.
| Compound Name | N-[2-(2,6-dimethylcyclohepta-1,3-dien-1-yl)ethenyl]methanimine |
|---|---|
| PubChem CID | 91443092 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-[2-(2,6-dimethylcyclohepta-1,3-dien-1-yl)ethenyl]methanimine |
| SMILES | C=NC=CC1=C(C)C=CCC(C)C1 |
| InChI | InChI=1S/C12H17N/c1-10-5-4-6-11(2)12(9-10)7-8-13-3/h4,6-8,10H,3,5,9H2,1-2H3 |
| InChIKey | UTIJMXFUULYARN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|