C10H15N — CID 123478687
N-(2,3-dimethylcyclohepta-1,6-dien-1-yl)methanimine (PubChem CID 123478687) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohepta-1,6-dien-1-yl)methanimine.
| Compound Name | N-(2,3-dimethylcyclohepta-1,6-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 123478687 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-(2,3-dimethylcyclohepta-1,6-dien-1-yl)methanimine |
| SMILES | C=NC1=C(C)C(C)CCC=C1 |
| InChI | InChI=1S/C10H15N/c1-8-6-4-5-7-10(11-3)9(8)2/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | PFRRPPMYWNRREV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|