C15H20N2 — CID 91524962
(7-butan-2-yl-8H-cyclohepta[b]pyridin-4-yl)methanamine (PubChem CID 91524962) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (7-butan-2-yl-8H-cyclohepta[b]pyridin-4-yl)methanamine.
| Compound Name | (7-butan-2-yl-8H-cyclohepta[b]pyridin-4-yl)methanamine |
|---|---|
| PubChem CID | 91524962 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (7-butan-2-yl-8H-cyclohepta[b]pyridin-4-yl)methanamine |
| SMILES | CCC(C)C1=CC=c2c(CN)ccnc2=CC1 |
| InChI | InChI=1S/C15H20N2/c1-3-11(2)12-4-6-14-13(10-16)8-9-17-15(14)7-5-12/h4,6-9,11H,3,5,10,16H2,1-2H3 |
| InChIKey | YRGOKNAENHPSIQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |