C12H17N — CID 91324852
2,3-di(ethylidene)-4-propan-2-ylpyridine (PubChem CID 91324852) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 2,3-di(ethylidene)-4-propan-2-ylpyridine.
| Compound Name | 2,3-di(ethylidene)-4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 91324852 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2,3-di(ethylidene)-4-propan-2-ylpyridine |
| SMILES | CC=c1nccc(C(C)C)c1=CC |
| InChI | InChI=1S/C12H17N/c1-5-10-11(9(3)4)7-8-13-12(10)6-2/h5-9H,1-4H3 |
| InChIKey | SVNVLCBYRKEHJZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |