C10H11N — CID 89356030
(7R)-7-methyl-6,7-dihydroquinoline (PubChem CID 89356030) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is (7R)-7-methyl-6,7-dihydroquinoline.
| Compound Name | (7R)-7-methyl-6,7-dihydroquinoline |
|---|---|
| PubChem CID | 89356030 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (7R)-7-methyl-6,7-dihydroquinoline |
| SMILES | C[C@H]1C=c2ncccc2=CC1 |
| InChI | InChI=1S/C10H11N/c1-8-4-5-9-3-2-6-11-10(9)7-8/h2-3,5-8H,4H2,1H3/t8-/m1/s1 |
| InChIKey | QUTPRDKZTUMSPK-MRVPVSSYSA-N |
| XLogP | 0.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |