C10H9F2N — CID 147742277
4,5-difluoro-7-methyl-6,7-dihydroquinoline (PubChem CID 147742277) has the molecular formula C10H9F2N and a molecular weight of 181.18 g/mol. Its IUPAC name is 4,5-difluoro-7-methyl-6,7-dihydroquinoline.
| Compound Name | 4,5-difluoro-7-methyl-6,7-dihydroquinoline |
|---|---|
| PubChem CID | 147742277 |
| Molecular Formula | C10H9F2N |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4,5-difluoro-7-methyl-6,7-dihydroquinoline |
| SMILES | CC1C=c2nccc(F)c2=C(F)C1 |
| InChI | InChI=1S/C10H9F2N/c1-6-4-8(12)10-7(11)2-3-13-9(10)5-6/h2-3,5-6H,4H2,1H3 |
| InChIKey | HAOKJOMHROQNCK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |