C15H26N2 — CID 144541876
N-[(Z)-2-imino-5-methylhex-3-en-3-yl]-4,4-dimethyl-2-methylidenepentan-1-imine (PubChem CID 144541876) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N-[(Z)-2-imino-5-methylhex-3-en-3-yl]-4,4-dimethyl-2-methylidenepentan-1-imine.
| Compound Name | N-[(Z)-2-imino-5-methylhex-3-en-3-yl]-4,4-dimethyl-2-methylidenepentan-1-imine |
|---|---|
| PubChem CID | 144541876 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-[(Z)-2-imino-5-methylhex-3-en-3-yl]-4,4-dimethyl-2-methylidenepentan-1-imine |
| SMILES | [H]/N=C(C)/C(=C/C(C)C)/N=C/C(=C)CC(C)(C)C |
| InChI | InChI=1S/C15H26N2/c1-11(2)8-14(13(4)16)17-10-12(3)9-15(5,6)7/h8,10-11,16H,3,9H2,1-2,4-7H3/b14-8-,16-13+,17-10+ |
| InChIKey | RGPFKMLDGYIJFD-YAOLCYBESA-N |
| XLogP | 4.63 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|