C15H22N2 — CID 123522463
(2Z)-N-[(Z)-4-cyclopropyl-4-iminobut-2-en-2-yl]-2-propan-2-ylpenta-2,4-dien-1-imine (PubChem CID 123522463) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (2Z)-N-[(Z)-4-cyclopropyl-4-iminobut-2-en-2-yl]-2-propan-2-ylpenta-2,4-dien-1-imine.
| Compound Name | (2Z)-N-[(Z)-4-cyclopropyl-4-iminobut-2-en-2-yl]-2-propan-2-ylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123522463 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (2Z)-N-[(Z)-4-cyclopropyl-4-iminobut-2-en-2-yl]-2-propan-2-ylpenta-2,4-dien-1-imine |
| SMILES | [H]/N=C(/C=C(C)\N=C\C(=C/C=C)C(C)C)C1CC1 |
| InChI | InChI=1S/C15H22N2/c1-5-6-14(11(2)3)10-17-12(4)9-15(16)13-7-8-13/h5-6,9-11,13,16H,1,7-8H2,2-4H3/b12-9-,14-6+,16-15-,17-10+ |
| InChIKey | KTSZKOAQYIDGLC-LNGRIHMXSA-N |
| XLogP | 4.16 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|