C18H24N2 — CID 138486150
(3Z,5Z)-2-N,9-dimethyl-7-methylidene-1-N-[(3E)-penta-1,3-dien-2-yl]deca-3,5,9-triene-1,2-diimine (PubChem CID 138486150) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (3Z,5Z)-2-N,9-dimethyl-7-methylidene-1-N-[(3E)-penta-1,3-dien-2-yl]deca-3,5,9-triene-1,2-diimine.
| Compound Name | (3Z,5Z)-2-N,9-dimethyl-7-methylidene-1-N-[(3E)-penta-1,3-dien-2-yl]deca-3,5,9-triene-1,2-diimine |
|---|---|
| PubChem CID | 138486150 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (3Z,5Z)-2-N,9-dimethyl-7-methylidene-1-N-[(3E)-penta-1,3-dien-2-yl]deca-3,5,9-triene-1,2-diimine |
| SMILES | C=C(C)CC(=C)/C=C\C=C/C(/C=N\C(=C)/C=C/C)=N/C |
| InChI | InChI=1S/C18H24N2/c1-7-10-17(5)20-14-18(19-6)12-9-8-11-16(4)13-15(2)3/h7-12,14H,2,4-5,13H2,1,3,6H3/b10-7+,11-8-,12-9-,19-18-,20-14+ |
| InChIKey | VZUWRIHKCKYXGQ-RAPRDLGTSA-N |
| XLogP | 4.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|