C22H33FN2 — CID 143763318
(E,2Z,3E)-6-N-(2,4-dimethylpenta-1,3-dien-3-yl)-2,3-di(ethylidene)-5-(2-fluoropropan-2-yl)-1-N-methylhept-4-ene-1,6-diimine (PubChem CID 143763318) has the molecular formula C22H33FN2 and a molecular weight of 344.52 g/mol. Its IUPAC name is (E,2Z,3E)-6-N-(2,4-dimethylpenta-1,3-dien-3-yl)-2,3-di(ethylidene)-5-(2-fluoropropan-2-yl)-1-N-methylhept-4-ene-1,6-diimine.
| Compound Name | (E,2Z,3E)-6-N-(2,4-dimethylpenta-1,3-dien-3-yl)-2,3-di(ethylidene)-5-(2-fluoropropan-2-yl)-1-N-methylhept-4-ene-1,6-diimine |
|---|---|
| PubChem CID | 143763318 |
| Molecular Formula | C22H33FN2 |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (E,2Z,3E)-6-N-(2,4-dimethylpenta-1,3-dien-3-yl)-2,3-di(ethylidene)-5-(2-fluoropropan-2-yl)-1-N-methylhept-4-ene-1,6-diimine |
| SMILES | C=C(C)C(/N=C(C)/C(=C\C(=C/C)C(=C\C)\C=N\C)C(C)(C)F)=C(C)C |
| InChI | InChI=1S/C22H33FN2/c1-11-18(19(12-2)14-24-10)13-20(22(8,9)23)17(7)25-21(15(3)4)16(5)6/h11-14H,3H2,1-2,4-10H3/b18-11+,19-12+,20-13+,24-14+,25-17+ |
| InChIKey | XZMOHNJUNWBDBE-FQCCYDECSA-N |
| XLogP | 6.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|