C12H20N2 — CID 123977223
(Z)-5-[(Z)-2-(ethylideneamino)ethenyl]oct-5-en-4-imine (PubChem CID 123977223) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (Z)-5-[(Z)-2-(ethylideneamino)ethenyl]oct-5-en-4-imine.
| Compound Name | (Z)-5-[(Z)-2-(ethylideneamino)ethenyl]oct-5-en-4-imine |
|---|---|
| PubChem CID | 123977223 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (Z)-5-[(Z)-2-(ethylideneamino)ethenyl]oct-5-en-4-imine |
| SMILES | [H]/N=C(CCC)/C(/C=C\N=C\C)=C\CC |
| InChI | InChI=1S/C12H20N2/c1-4-7-11(9-10-14-6-3)12(13)8-5-2/h6-7,9-10,13H,4-5,8H2,1-3H3/b10-9-,11-7-,13-12+,14-6+ |
| InChIKey | BAWHRTCTJQZIRF-OVOVSVNDSA-N |
| XLogP | 3.75 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|