C14H16N2 — CID 142875295
8-methyl-8-(2-methylprop-2-enyl)pyrido[3,2-b]azepine (PubChem CID 142875295) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 8-methyl-8-(2-methylprop-2-enyl)pyrido[3,2-b]azepine.
| Compound Name | 8-methyl-8-(2-methylprop-2-enyl)pyrido[3,2-b]azepine |
|---|---|
| PubChem CID | 142875295 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 8-methyl-8-(2-methylprop-2-enyl)pyrido[3,2-b]azepine |
| SMILES | C=C(C)CC1(C)C=CN=c2cccnc2=C1 |
| InChI | InChI=1S/C14H16N2/c1-11(2)9-14(3)6-8-16-12-5-4-7-15-13(12)10-14/h4-8,10H,1,9H2,2-3H3 |
| InChIKey | MKKQUWCWTWWFPI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|