C11H14N2 — CID 142875425
8,8-dimethyl-6,7-dihydropyrido[3,2-b]azepine (PubChem CID 142875425) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 8,8-dimethyl-6,7-dihydropyrido[3,2-b]azepine.
| Compound Name | 8,8-dimethyl-6,7-dihydropyrido[3,2-b]azepine |
|---|---|
| PubChem CID | 142875425 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 8,8-dimethyl-6,7-dihydropyrido[3,2-b]azepine |
| SMILES | CC1(C)C=c2ncccc2=NCC1 |
| InChI | InChI=1S/C11H14N2/c1-11(2)5-7-13-9-4-3-6-12-10(9)8-11/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | TXOSXDGPEWIKMX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |